Details for Nickel Acetate
Nickel Acetate
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
6018-89-9 |
EC NO: |
206-761-7 |
Molecular Formula: |
C4H14NiO8 |
Molecular Weight: |
248.84036 |
Specification: |
|
InChI: |
InChI=1/C2H4O2.Ni.4H2O/c1-2(3)4;;;;;/h1H3,(H,3,4);;4*1H2/q;+2;;;;/p-1 |
Synonyms: |
Acetic acid nickel(II) salt;Nickel acetate tetrahydrate;Nickel(II) acetate tetrahydrate;Nickel ii acetate tetrahydrate;nickel(2+) acetate hydrate (1:2:4);acetate, nickel(2+) salt, hydrate (1:1:4); |
Molecular Structure: |
|
if you are sourcing Nickel Acetate from United-States ,just feel free to inquire