Details for nickel nitrate hexahydrate
![](/images/home/newal1.gif)
nickel nitrate hexahydrate
111Category: |
Catalyst and Auxiliary |
|
CAS NO: |
13478-00-7 |
EC NO: |
|
Molecular Formula: |
Ni(NO3)2¡¤6H2O |
Molecular Weight: |
290.79 |
Specification: |
|
InChI: |
InChI=1/NO3.Ni.6H2O/c2-1(3)4;;;;;;;/h;;6*1H2/q-1;+2;;;;;; |
Synonyms: |
Nickel nitrate,hexahydrate;Nickelous nitrate hexahydrate;Nickel(II)Nitrate Hexahydrate;Nickelous nitrate, 6-hydrate;nickel nitrate hexahydrate;Nitric acid, nickel(2+)salt hexahydrate;Nickel (II) Nitrate Hexahydrate; |
Molecular Structure: |
![nickel nitrate hexahydrate 13478-00-7](https://images-a.chemnet.com/suppliers/chembase/160/160247_1.gif) |
if you are sourcing nickel nitrate hexahydrate from China ,just feel free to inquire