Details for nickel nitrate hexahydrate

nickel nitrate hexahydrate
| Category: |
Catalyst and Auxiliary |
|
| CAS NO: |
13478-00-7 |
| EC NO: |
|
| Molecular Formula: |
Ni(NO3)2ยท6H2O |
| Molecular Weight: |
290.79 |
| Specification: |
|
| InChI: |
InChI=1/NO3.Ni.6H2O/c2-1(3)4;;;;;;;/h;;6*1H2/q-1;+2;;;;;; |
| Synonyms: |
Nickel nitrate,hexahydrate;Nickelous nitrate hexahydrate;Nickel(II)Nitrate Hexahydrate;Nickelous nitrate, 6-hydrate;nickel nitrate hexahydrate;Nitric acid, nickel(2+)salt hexahydrate;Nickel (II) Nitrate Hexahydrate; |
| Molecular Structure: |
 |
if you are sourcing nickel nitrate hexahydrate from China ,just feel free to inquire