Details for 2-Methylbutyric Acid
2-Methylbutyric Acid
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
116-53-0 |
EC NO: |
204-145-2 |
Molecular Formula: |
C5H9O2 |
Molecular Weight: |
101.1243 |
Specification: |
|
InChI: |
InChI=1/C5H10O2/c1-3-4(2)5(6)7/h4H,3H2,1-2H3,(H,6,7)/p-1/t4-/m0/s1 |
Synonyms: |
(+/-)-2-Methylbutyric Acid;2-Methylbutanoic Acid;Natural 2-Methyl Butyric Acid;D-2-Methyl Butyric Acid;2-Methyl Butyic Acid;(2S)-2-methylbutanoic acid;(2R)-2-methylbutanoate;(2S)-2-methylbutanoate;2-Methyl Butyric Acid; |
Molecular Structure: |
|
if you are sourcing 2-Methylbutyric Acid from United-States ,just feel free to inquire