Details for Ciclopirox Olamine
Ciclopirox Olamine
| 111Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
41621-49-2 |
| EC NO: |
255-464-9 |
| Molecular Formula: |
C14H24N2O3 |
| Molecular Weight: |
268.352 |
| Specification: |
|
| InChI: |
InChI=1/C12H17NO2.C2H7NO/c1-9-7-11(13(15)12(14)8-9)10-5-3-2-4-6-10;3-1-2-4/h7-8,10,15H,2-6H2,1H3;4H,1-3H2 |
| Synonyms: |
6-CYCLOHEXYL-1-HYDROXY-4-METHYL-1H-PYRIDIN-2-ONE, 2-AMINO-ETHANOL;6-CYCLOHEXYL-1-HYDROXY-4-METHYL-2[1H]-PYRIDONE ETHANOLAMINE SALT;6-CYCLOHEXYL-1-HYDROXY-4-METHYL-2(1H)-PYRIDONE ETHANOLAMMONIUM SALT;6-cyclohexyl-1-hydroxy-4-methylpyridin-2(1h)-one 2-aminoethanol (1:1);ciclopirox ethanolamine;6-cyclohexyl-1-hydroxy-4-methylpyridin-2(1H)-one-2-aminoethanol (1:1); |
| Molecular Structure: |
 |
if you are sourcing Ciclopirox Olamine from China ,just feel free to inquire
CN
China Suppliers > sunwell-chem > 
Search Product