Details for Tropisetron HCL
Tropisetron HCL
| 111Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
105826-92-4 |
| EC NO: |
|
| Molecular Formula: |
C17H21ClN2O2 |
| Molecular Weight: |
320.8138 |
| Specification: |
|
| InChI: |
InChI=1/C17H20N2O2.ClH/c1-19-11-6-7-12(19)9-13(8-11)21-17(20)15-10-18-16-5-3-2-4-14(15)16;/h2-5,10-13,18H,6-9H2,1H3;1H |
| Synonyms: |
Tropisetron HCl;(1R,5S)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl 1H-indole-3-carboxylate hydrochloride (1:1);8-methyl-8-azabicyclo[3.2.1]oct-3-yl 1H-indole-3-carboxylate hydrochloride (1:1);Tropiserton Hydrochloride; |
| Molecular Structure: |
 |
if you are sourcing Tropisetron HCL from China ,just feel free to inquire
CN
China Suppliers > sunwell-chem > 
Search Product