Details for Isobutenyl chloride
Isobutenyl chloride
| 111Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
513-37-1 |
| EC NO: |
208-158-4 |
| Molecular Formula: |
C4H7Cl |
| Molecular Weight: |
90.5514 |
| Specification: |
|
| InChI: |
InChI=1/C4H7Cl/c1-4(2)3-5/h3H,1-2H3 |
| Synonyms: |
Chloromethylpropene;1-Chloro-2-methyl-1-propene;1-chloro-2-methylprop-1-ene;Isobutenyl chloride;1-chloro-2-methyl-1-butene; isobutylene chloride;isobutylene chloride; chloroisobutylene; 2,2-dimethylchloroethylene; |
| Molecular Structure: |
 |
if you are sourcing Isobutenyl chloride from China ,just feel free to inquire
CN
China Suppliers > yide-chem > 
Search Product