Details for 2-Fluoro-4-methoxybenzoic acid
![](/images/home/newal1.gif)
2-Fluoro-4-methoxybenzoic acid
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
394-42-3 |
EC NO: |
|
Molecular Formula: |
C8H6ClFO2 |
Molecular Weight: |
188.5834 |
Specification: |
98% |
InChI: |
InChI=1/C8H6ClFO2/c1-12-5-2-3-6(8(9)11)7(10)4-5/h2-4H,1H3 |
Synonyms: |
2-FLUORO-P-ANISIC ACID;BUTTPARK 32\01-80;RARECHEM AL BE 0456;2-fluoro-4-methoxybenzoate;2-Fluoro-4-Methoxy Benzoic Acid;2-fluoro-4-methoxybenzoyl chloride; |
Molecular Structure: |
![2-Fluoro-4-methoxybenzoic acid 394-42-3](https://images-a.chemnet.com/suppliers/chembase/294/294246_1.gif) |
if you are sourcing 2-Fluoro-4-methoxybenzoic acid from United-States ,just feel free to inquire