Details for BENTONITE

BENTONITE
| Category: |
Inorganic chemicals |
|
| CAS NO: |
1302-78-9 |
| EC NO: |
215-108-5 |
| Molecular Formula: |
C6H12N4O9 |
| Molecular Weight: |
284.1809 |
| Specification: |
|
| InChI: |
InChI=1/C6H12N4O9/c11-8(12)17-4-1-7(2-5-18-9(13)14)3-6-19-10(15)16/h1-6H2 |
Product description:
The color varies from yellowish to white and is almost odorless.As of fuller's earth, as emulsifier for oils, as a base for plasters. Pharmaceutical aid (suspending agent). |
| Synonyms: |
Bentonites;Lecithinase C;Bentonite;nitrilotriethane-2,1-diyl trinitrate; |
| Molecular Structure: |
 |
if you are sourcing BENTONITE from Other-Regions ,just feel free to inquire