Details for 3-bromopropionic acid
3-bromopropionic acid
| 111Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
590-92-1 |
| EC NO: |
209-694-1 |
| Molecular Formula: |
C3H4BrO2 |
| Molecular Weight: |
151.9672 |
| Specification: |
|
| InChI: |
InChI=1/C3H5BrO2/c4-2-1-3(5)6/h1-2H2,(H,5,6)/p-1 |
| Synonyms: |
3-Bromo-propionic acid;2-Carboxyethyl bromide;2-carboxyethylbromide;3-Bromopropanoic acid;3-bromo-propanoicaci;3-bromopropanoicacid;3-bromo-Propanoicacid;3-bromo-propionicaci;3-Bromoprpionicacid;beta-bromopropanoicacid;-Bromopropionicacid
Propanoicacid,3-bromo-;Propionic acid, 3-bromo-;3-BROMPROPIONIC ACID;BETA-BROMOPROPIONIC ACID;B-BROMOPROPIONIC ACID;beta Bromo Propionic Acid;¦Â£bromopropionic acid;Propanoic acid,3-bromo-;3-bromopropanoate; |
| Molecular Structure: |
 |
if you are sourcing 3-bromopropionic acid from China ,just feel free to inquire
CN
China Suppliers > chemhx > 
Search Product