Details for Benzyl Acetate

Benzyl Acetate
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
140-11-4 |
EC NO: |
205-399-7 |
Molecular Formula: |
C9H10O2 |
Molecular Weight: |
150.1745 |
Specification: |
|
InChI: |
InChI=1/C9H10O2/c1-8(10)11-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3 |
Product description:
Colorless liquid, jasmine-like odor.In perfumery, solvent for cellulose acetate and nitrate. |
Synonyms: |
Acetic acid benzyl ester;Benzyl ethanoate;
;3-phenylpropanoate; |
Molecular Structure: |
 |
if you are sourcing Benzyl Acetate from India ,just feel free to inquire