111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
532-32-1 |
EC NO: |
208-534-8 |
Molecular Formula: |
C7H5NaO2 |
Molecular Weight: |
144.1032 |
Specification: |
|
InChI: |
InChI=1/C7H6O2.Na/c8-7(9)6-4-2-1-3-5-6;/h1-5H,(H,8,9);/q;+1/p-1 |
Product description:
White granules or colorless crystalline powder, odorless.Food preservative, antiseptic, medicine, tobacco, pharmaceutical preparations, intermediate for manufacture of dyes, rust and mildew inhibitor. |
Synonyms: |
Sodium benzoate;Benzoic acid sodium salt;benzoic acid sodium crystalline;benzoic acid sodium sigmaultra;Benzoic acid,sodium salt; |
Molecular Structure: |
 |