Details for n-Butyl Methacrylate
n-Butyl Methacrylate
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
97-88-1 |
EC NO: |
202-615-1 |
Molecular Formula: |
C8H14O2 |
Molecular Weight: |
142.1979 |
Specification: |
|
InChI: |
InChI=1/C8H14O2/c1-4-6(2)5-7(3)8(9)10/h6H,3-5H2,1-2H3,(H,9,10)/p-1 |
Synonyms: |
2-Methyl-2-Propenoic Acid Butyl Ester;2-Methyl butyl acrylate;Butyl 2-Methyl-2-Propenate;butyl 2-methyl-2-propenoate;Butyl methacrylate, stabilized with 25 ppm methylhydroquinone;n-Butyl Methacrylate;4-methyl-2-methylidenehexanoate;n-Butyl Methylacrylate;BMA; |
Molecular Structure: |
|
if you are sourcing n-Butyl Methacrylate from United-States ,just feel free to inquire