Details for Ethyl Pyruvate
![](/images/home/newal1.gif)
Ethyl Pyruvate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
617-35-6 |
EC NO: |
210-511-2 |
Molecular Formula: |
C5H8O3 |
Molecular Weight: |
116.1152 |
Specification: |
|
InChI: |
InChI=1/C5H8O3/c1-3-8-5(7)4(2)6/h3H2,1-2H3 |
Product description:
Clear slightly yellow. |
Synonyms: |
Ethyl 2-oxopropionate;Ethyl pyruvate,(Pyruvic acid ethyl ester);Pyruvic acid ethyl ester;Brenztraubensaeure-ethylester;ethyl 2-oxopropanoate; |
Molecular Structure: |
![Ethyl Pyruvate 617-35-6](https://images-a.chemnet.com/suppliers/chembase/150/1509.gif) |
if you are sourcing Ethyl Pyruvate from United-States ,just feel free to inquire