Details for Ethyl 4-ethoxybenzoate
Ethyl 4-ethoxybenzoate
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
23676-09-7 |
EC NO: |
245-818-0 |
Molecular Formula: |
C11H14O3 |
Molecular Weight: |
194.2271 |
Specification: |
|
InChI: |
InChI=1/C11H14O3/c1-3-13-10-7-5-9(6-8-10)11(12)14-4-2/h5-8H,3-4H2,1-2H3 |
Synonyms: |
4-Ethoxy-benzoic acid ethyl ester; Ethyl-p-Ethoxy-Benzoate/PEEB; PEEB; ;Ethyl 4-Etoxybenzoate; |
Molecular Structure: |
|
if you are sourcing Ethyl 4-ethoxybenzoate from Switzerland ,just feel free to inquire