Details for Methyl isobutyryl acetate
Methyl isobutyryl acetate
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
42558-54-3 |
EC NO: |
|
Molecular Formula: |
C7H12O3 |
Molecular Weight: |
144.1684 |
Specification: |
|
InChI: |
InChI=1/C7H12O3/c1-4-6(8)10-7(9)5(2)3/h5H,4H2,1-3H3 |
Synonyms: |
methyl Isobutyrylacetate;methyl Isobutyloylacetate;methyl 4-methyl-3-oxopentanoate;methyl 4-methyl-3-oxovalerate;ibem;Isobutylacetic acid methyl ester;Iso-butyryl methyl acetate;4-methyl-3-oxo-pentanoic acid methyl ester;Pentanoic acid, 4-methyl-3-oxo-, methyl ester;Methyl Isobutylacetate;2-methylpropanoic propanoic anhydride;Methyl 3-oxo-4-methyl pentanoate;EthylIsobutyl Acetate; |
Molecular Structure: |
|
if you are sourcing Methyl isobutyryl acetate from Switzerland ,just feel free to inquire