Details for Naphthenic acids, sodium salts

Naphthenic acids, sodium salts
111Category: |
Catalyst and Auxiliary |
|
CAS NO: |
61790-13-4 |
EC NO: |
263-108-9 |
Molecular Formula: |
C10H17NaO2 |
Molecular Weight: |
192.2305 |
Specification: |
|
InChI: |
InChI=1/C10H18O2.Na/c1-2-8-3-4-9(7-8)5-6-10(11)12;/h8-9H,2-7H2,1H3,(H,11,12);/q;+1/p-1 |
Synonyms: |
Caswell No. 589E;EPA Pesticide Chemical Code 589600;Naphthathenic soap;Naphthenic acid, sodium salt solution;Sodium naphthenate;sodium 3-(3-ethylcyclopentyl)propanoate; |
Molecular Structure: |
 |
if you are sourcing Naphthenic acids, sodium salts from China ,just feel free to inquire