Details for Sodium 4-chlorobenzene sulfinate
![](/images/home/newal1.gif)
Sodium 4-chlorobenzene sulfinate
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
14752-66-0 |
EC NO: |
238-811-9 |
Molecular Formula: |
C6H4ClNaO2S |
Molecular Weight: |
198.6025 |
Specification: |
|
InChI: |
InChI=1/C6H5ClO2S.Na/c7-5-1-3-6(4-2-5)10(8)9;/h1-4H,(H,8,9);/q;+1/p-1 |
Synonyms: |
4-Chlorobenzenesulfinic acid sodium salt hydrate;4-Chlorobenzenesulfinic acid sodium salt4;4-chlorobenzenesulfinate;sodium 4-chlorobenzenesulfinate; |
Molecular Structure: |
![Sodium 4-chlorobenzene sulfinate 14752-66-0](https://images-a.chemnet.com/suppliers/chembase/736/7361.gif) |
if you are sourcing Sodium 4-chlorobenzene sulfinate from China ,just feel free to inquire