Details for 1-Methyl-5-amino-1H-benzimidazole-2-butanoic acid ethyl ester

1-Methyl-5-amino-1H-benzimidazole-2-butanoic acid ethyl ester
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
3543-73-5 |
EC NO: |
|
Molecular Formula: |
C14H19N3O2 |
Molecular Weight: |
261.3196 |
Specification: |
|
InChI: |
InChI=1/C14H19N3O2/c1-3-19-14(18)6-4-5-13-16-11-9-10(15)7-8-12(11)17(13)2/h7-9H,3-6,15H2,1-2H3 |
Synonyms: |
4-(5-amino-1-methyl-1H-benzoimidazol-2-yl)-butyric acid ethyl ester;5-amino-1-methyl-1H-Benzimidazole-2-butanoic acid ethyl ester;5-amino-1-methyl-2-Benzimidazolebutyric acid ethyl ester; |
Molecular Structure: |
 |
if you are sourcing 1-Methyl-5-amino-1H-benzimidazole-2-butanoic acid ethyl ester from China ,just feel free to inquire