Details for 2-Iodo-5-methylbenzoic acid methyl ester

2-Iodo-5-methylbenzoic acid methyl ester
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
103440-52-4 |
EC NO: |
|
Molecular Formula: |
C9H9IO2 |
Molecular Weight: |
276.071 |
Specification: |
|
InChI: |
InChI=1/C9H9IO2/c1-6-3-4-8(10)7(5-6)9(11)12-2/h3-5H,1-2H3 |
Synonyms: |
benzoic acid, 2-iodo-5-methyl-, methyl ester;2-Iodo-5-methylbenzoic acid methyl ester; |
Molecular Structure: |
 |
if you are sourcing 2-Iodo-5-methylbenzoic acid methyl ester from China ,just feel free to inquire