Details for Glycine ethyl ester hydrochloride
![](/images/home/newal1.gif)
Glycine ethyl ester hydrochloride
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
623-33-6 |
EC NO: |
210-787-4 |
Molecular Formula: |
C4H10NO2Cl |
Molecular Weight: |
104.1272 |
Specification: |
|
InChI: |
InChI=1/C4H9NO2/c1-2-7-4(6)3-5/h2-3,5H2,1H3/p+1 |
Synonyms: |
Ethyl glycinate hydrochloride~H-Gly-OEt.HCl;Glycine Ethyl Ester HCL;H-Gly-OEt.HCl;H-Gly-OEt*HCl;Ethyl Glycinate, HCl (1.00893);Glycine ethyhydnchlordeester;Gly-oet-hcl;2-ethoxy-2-oxoethanaminium;Glycocollethylesterhydrochloride;usafdo-10;H-Gly-OEt¡¤HCl;Glycine Ethylester Hydrochoride;H-Gly-OEt•HCl; |
Molecular Structure: |
![Glycine ethyl ester hydrochloride 623-33-6](https://images-a.chemnet.com/suppliers/chembase/606/101606_1.gif) |
if you are sourcing Glycine ethyl ester hydrochloride from China ,just feel free to inquire