Details for Methyl 4-amino-2-methoxybenzoate
![](/images/home/newal1.gif)
Methyl 4-amino-2-methoxybenzoate
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
27492-84-8 |
EC NO: |
248-494-9 |
Molecular Formula: |
C9H11NO3 |
Molecular Weight: |
181.1885 |
Specification: |
|
InChI: |
InChI=1/C9H11NO3/c1-12-8-5-6(10)3-4-7(8)9(11)13-2/h3-5H,10H2,1-2H3 |
Synonyms: |
Methyl 4-amino-2-methoxybenzenecarboxylate;4-AMINO-2-methoxybenzoic acid methyl ester;methyl 4-amino-o-anisate;4-Amino-2-methoxy benzoic acid;4-Amino-2-methoxy methyl benzoate;4-Amino-2-Methoxy-Benzoic Acid Methyl Ester; |
Molecular Structure: |
![Methyl 4-amino-2-methoxybenzoate 27492-84-8](https://images-a.chemnet.com/suppliers/chembase/127/127868_1.gif) |
if you are sourcing Methyl 4-amino-2-methoxybenzoate from China ,just feel free to inquire