Details for 2,5-Dimethyl pyrazine

2,5-Dimethyl pyrazine
111Category: |
Intermediates |
|
CAS NO: |
123-32-0 |
EC NO: |
204-618-3 |
Molecular Formula: |
C6H8N2 |
Molecular Weight: |
108.1411 |
Specification: |
|
InChI: |
InChI=1/C6H8N2/c1-5-3-8-6(2)4-7-5/h3-4H,1-2H3 |
Product description:
Clear, colorless to pale yellow liquid.Stable under normal temperatures and pressures. |
Synonyms: |
Ketine;2,5-Dimethyl-1,4-diazine;2,5-Dimethyl pyrazine;2,5-methyl pyrazine; |
Molecular Structure: |
 |
if you are sourcing 2,5-Dimethyl pyrazine from India ,just feel free to inquire