Details for Hydroxy propyl acrylate
Hydroxy propyl acrylate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
25584-83-2 |
EC NO: |
247-118-0 |
Molecular Formula: |
C6H10O3 |
Molecular Weight: |
130.1418 |
Specification: |
|
InChI: |
InChI=1/C6H10O3/c1-3-5(7)9-6(8)4-2/h3,6,8H,1,4H2,2H3 |
Synonyms: |
Hydroxypropyl acrylate,mixture of isomers;Acrylic acid hydroxypropyl ester;BISOMER HPA;2-hydroxypropyl prop-2-enoate;1-hydroxypropan-2-yl prop-2-enoate;1-hydroxypropyl prop-2-enoate;Hydroxypropyl acrylate; |
Molecular Structure: |
|
if you are sourcing Hydroxy propyl acrylate from China ,just feel free to inquire