Details for Diphenyl Oxide

Diphenyl Oxide
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
101-84-8 |
EC NO: |
202-981-2 |
Molecular Formula: |
C12H10O |
Molecular Weight: |
170.2072 |
Specification: |
|
InChI: |
InChI=1/C12H10O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H |
Product description:
Phenyl ether CAS: 101-84-8 Formula: C12H10O 1,1'-Oxybisbenzene Diphenyl ether Diphenyl oxide Phenoxybenzen PubChem: 7583 EC (EINECS/ELINCS): 202-981-2 RTECS: KN8970000 UN: 3077 Merck: 12,7442 Beilstein/Gmelin: 1364620 Beilstein Reference: 4-06-00-00568 Swiss Giftliste 1: G-5048 |
Synonyms: |
1,1'-oxybisbenzene;diphenyl ether;Diphenyl Oxide;phenoxybenzene;1,1'-oxydibenzene;Dipnenyl ether;Di(diiphenyl) ether;Biphenyl oxide; |
Molecular Structure: |
 |
if you are sourcing Diphenyl Oxide from China ,just feel free to inquire