Details for Lithium oxalate
Lithium oxalate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
553-91-3 |
EC NO: |
209-054-1 |
Molecular Formula: |
C2Li2O4 |
Molecular Weight: |
101.901 |
Specification: |
|
InChI: |
InChI=1/C2H2O4.2Li/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;/q;2*+1/p-2 |
Synonyms: |
dilithium oxalate;dilithium ethanedioate;Lithium oxalate;Ethanedioic acid, dilithium salt;ethanedioic acid, lithium salt (1:2);Oxalic acid, dilithium salt; |
Molecular Structure: |
|
if you are sourcing Lithium oxalate from India ,just feel free to inquire