Details for Di-Iso amyl Phthalate
![](/images/home/newal1.gif)
Di-Iso amyl Phthalate
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
605-50-5 |
EC NO: |
210-088-4 |
Molecular Formula: |
C18H26O4 |
Molecular Weight: |
306.3966 |
Specification: |
|
InChI: |
InChI=1/C18H26O4/c1-13(2)9-11-21-17(19)15-7-5-6-8-16(15)18(20)22-12-10-14(3)4/h5-8,13-14H,9-12H2,1-4H3 |
Synonyms: |
Isoamyl phthalate;AI3-04281;BRN 2134957;Bis(3-methylbutyl) phthalate;Diisoamyl phthalate;Disoamyl phthalate;NSC 17070;1,2-Benzenedicarboxylic acid, bis(3-methylbutyl) ester;Phthalic acid, diisopentyl ester;bis(3-methylbutyl) benzene-1,2-dicarboxylate; |
Molecular Structure: |
![Di-Iso amyl Phthalate 605-50-5](https://images-a.chemnet.com/suppliers/chembase/cas9/cas605-50-5.gif) |
if you are sourcing Di-Iso amyl Phthalate from India ,just feel free to inquire