Details for 3-Methylphenylacetic acid
3-Methylphenylacetic acid
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
621-36-3 |
EC NO: |
210-683-9 |
Molecular Formula: |
C9H9O2 |
Molecular Weight: |
149.1671 |
Specification: |
|
InChI: |
InChI=1/C9H10O2/c1-7-3-2-4-8(5-7)6-9(10)11/h2-5H,6H2,1H3,(H,10,11)/p-1 |
Synonyms: |
m-Methylphenylacetic acid;meta-tolylacetic acid;m-Tolyacetic Acid;(3-methylphenyl)acetic acid;(3-methylphenyl)acetate;3-Methylphenylacetic acid;meta methylphenylacetic acid;methyll 3-methylphenylacetate; |
Molecular Structure: |
|
if you are sourcing 3-Methylphenylacetic acid from Belgium ,just feel free to inquire