Details for Naphthalene-1-boronic acid
![](/images/home/newal1.gif)
Naphthalene-1-boronic acid
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
13922-41-3 |
EC NO: |
|
Molecular Formula: |
C10H9BO2 |
Molecular Weight: |
171.9883 |
Specification: |
|
InChI: |
InChI=1/C10H9BO2/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h1-7,12-13H |
Synonyms: |
1-Naphthaleneboronic acid;1-Naphthylbenzoic acid;naphthalen-1-ylboronic acid;Naphthalene-1-boronic acid;RARECHEM AH PB 0125;ALPHA-NAPHTHYLBORIC ACID;naphthalen-1-yl-1-boronic acid;Naphthalenyl-1-boronic acid; |
Molecular Structure: |
![Naphthalene-1-boronic acid 13922-41-3](https://images-a.chemnet.com/suppliers/chembase/203/203868_1.gif) |
if you are sourcing Naphthalene-1-boronic acid from Australia ,just feel free to inquire