year
111Category: | Organic chemicals and Derivatives |
|
||||||||||
CAS NO: | 16219-75-3 | |||||||||||
EC NO: | 240-347-7 | |||||||||||
Molecular Formula: | C9H12 | |||||||||||
Molecular Weight: | 120.1916 | |||||||||||
Specification: | ||||||||||||
InChI: | InChI=1/C9H12/c1-2-8-5-7-3-4-9(8)6-7/h2-4,7,9H,5-6H2,1H3/b8-2+ | |||||||||||
Product description: 1. Product name: Ethylidene Norbornene
5. Feature: stored in containers filled with nitrogen gas; no contact with oxygen. "Inflammable Liquid" label should be used. |
||||||||||||
Synonyms: | 5-ethylidene-8,9,10-trinorborn-2-ene;5-ethylidenebicyclo(2.2.1)hept-2-ene;(5E)-5-ethylidenebicyclo[2.2.1]hept-2-ene;Ethylidene Norbornene; | |||||||||||
Molecular Structure: |