111Category: |
Catalyst and Auxiliary/Water Treatment Chemicals |
|
CAS NO: |
2893-78-9 |
EC NO: |
220-767-7 |
Molecular Formula: |
C3Cl2N3NaO3 |
Molecular Weight: |
219.9462 |
Specification: |
|
InChI: |
InChI=1/C3HCl2N3O3.Na/c4-7-1(9)6-2(10)8(5)3(7)11;/h(H,6,9,10);/q;+1/p-1 |
Product description:
Product Name : Sodium dichloroisocyanurate |
intro:
Molecular formula: C3O3N3CL2Na Structural formula:
Uses: disinfectant, which can be used to disinfect drink water, prophylactic disinfection and environmental disinfection; or used in the disinfection of silk worm, animals, birds and fish. It also can be used in anti-shrinkage finishing of wool, textile bleaching, algae-removing in circulating water and chlorinated agent of rubber. Specification:
1. Preparation: |
white powder, granule or tablet. |
2. Active chlorine: |
≥56%, ≥60%. |
3. Ph vale of 1% solution: |
5.6-7.0 |
4. granule Specification: |
8~30, 20~60 |
5.tablet Specification: |
1g/tablet, 5g/tablet, 15g/tablet, 50g/tablet, 200g/tablet, (or following your demands). |
6.Packing and weight( net wt): |
cardboard drum 50kg plastic drum 50kg plastic woven bag 25kg (or following your demands). |
Technical Index:
Index name |
Index |
Index |
Appearance |
white granule or powder |
white granule or powder |
Active chlorine % |
≥60 |
≥56 |
Ph vale of 1% solution(25癈) |
5.6-7.0 |
5.6-7.0 |
Water insoluble matter % |
≤0.1 |
≤0.1 | |
Synonyms: |
1-Sodium-3,5-dichloro-s-triazine-2,4,6-trione;Dichloro-s-triazine-2,4,6-(1H,3H,5H)-trione sodium salt;Sodium dichloroisocyanurate;Dichloroisocyanuric acid sodium salt;1,3-Dichloro-6-hydroxy-1,3,5-triazine-2,4-dione sodium salt;SDIC;sodium 3,5-dichloro-2,4,6-trioxo-1,3,5-triazinan-1-ide;Troclosene sodium; |
Molecular Structure: |
|