111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
111-20-6 |
EC NO: |
203-845-5 |
Molecular Formula: |
C10H18O4 |
Molecular Weight: |
202.25052 |
Specification: |
|
InChI: |
InChI=1/C10H18O4/c11-9(12)7-5-3-1-2-4-6-8-10(13)14/h1-8H2,(H,11,12)(H,13,14)/p-2 |
Product description:
Raw material in the production of synthetic resins of the alkylated or polyester type, non-migrating plasticizers, polyester rubbers, synthetic fibers of the polyamide type. |
Synonyms: |
1,8-Octanedicarboxylic acid;Decanedioic acid;Octane-1,8-dicarboxylic acid;decanedioate; |
Molecular Structure: |
![Sebacic Acid 111-20-6](https://images-a.chemnet.com/suppliers/chembase/255/2556.gif) |