Details for Di(propylene glycol)methyl ether acetate

Di(propylene glycol)methyl ether acetate
111Category: |
Intermediates |
|
CAS NO: |
88917-22-0 |
EC NO: |
|
Molecular Formula: |
C9H18O4 |
Molecular Weight: |
190.2368 |
Specification: |
|
InChI: |
InChI=1/C9H18O4/c1-9(10)13-8-4-7-12-6-3-5-11-2/h3-8H2,1-2H3 |
Synonyms: |
Di(propylene glycol) methyl ether acetate,mixture of isomers;1-(3-methoxypropoxy)propyl acetate;3-(3-methoxypropoxy)propyl acetate;Dipropylene glycol monomethyl ether acetate;DPMA; |
Molecular Structure: |
 |
if you are sourcing Di(propylene glycol)methyl ether acetate from China ,just feel free to inquire