Details for Tioconazole

Tioconazole
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
65899-73-2 |
| EC NO: |
265-973-8 |
| Molecular Formula: |
C16H13Cl3N2OS |
| Molecular Weight: |
387.7112 |
| Specification: |
|
| InChI: |
InChI=1/C16H13Cl3N2OS/c17-12-1-2-13(14(18)7-12)15(8-21-5-4-20-10-21)22-9-11-3-6-23-16(11)19/h1-7,10,15H,8-9H2 |
| Synonyms: |
1-[2-[(2-Chlorothiophen-3-yl)methoxy]-2-(2,4-dichlorophenyl)-ethyl]imidazole;Vagistat;1-{2-[(2-chlorothiophen-3-yl)methoxy]-2-(2,4-dichlorophenyl)ethyl}-1H-imidazole; |
| Molecular Structure: |
 |
if you are sourcing Tioconazole from China ,just feel free to inquire