Details for D-ornithine monohydrochloride
![](/images/home/newal1.gif)
D-ornithine monohydrochloride
111Category: |
Pharmaceuticals and Biochemicals/Vitamin, amino acids and coenzymes |
|
CAS NO: |
16682-12-5 |
EC NO: |
240-729-3 |
Molecular Formula: |
C5H13N2O2 |
Molecular Weight: |
133.1684 |
Specification: |
|
InChI: |
InChI=1/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/p+1/t4-/m1/s1 |
Synonyms: |
D-(-)-Ornithine hydrochloride;D-Ornithine Monohydrochloride;D-Omithine HCl;D-ornithine hydrochloride (1:1);(2R)-2,5-diammoniopentanoate;D-Ornithine HCL;D-Orn.HCL;H-D-Orn-OH¡¤HCl;R-2,5-Diaminopentanoic Acidhydrochloride; |
Molecular Structure: |
![D-ornithine monohydrochloride 16682-12-5](https://images-a.chemnet.com/suppliers/chembase/cas/cas16682-12-5.gif) |
if you are sourcing D-ornithine monohydrochloride from China ,just feel free to inquire