year
111Category: | Intermediates/Pharmaceutical intermediates |
|
|
CAS NO: | 141-01-5 | ||
EC NO: | 205-447-7 | ||
Molecular Formula: | C4H2FeO4 | ||
Molecular Weight: | 169.9013 | ||
Specification: | BP USP food additives(nutritional supplement) | ||
InChI: | InChI=1/C4H4O4.Fe/c5-3(6)1-2-4(7)8;/h1-2H,(H,5,6)(H,7,8);/q;+2/p-2 | ||
Packing: | 25kg/bag, 25kg/drum or 1MT/bag | ||
Product description: Specifications Ferrous Fumarate CAS141-01-5 1. Comply with FCC/BP/USP. 2. ISO9001:2008/KOSHER/CNAS Laboratory Certificate 3. Manufacture Ferrous Fumarate CAS141-01-5 FCC BP USP food additives(nutritional supplement) 1.Description: Molecular formula: C4H2FeO4. Molecular weight: 169.89. Color: red-orange to red-brown powder. Solubility: lightly dissolved in water and ethanol. Application: food, pharmaceutical, healthcare product, salt industry, etc. 3. Storage: stored in a cool, dry and ventilated warehouse, to prevent the heat or sun exposure, prohibited mixed with hazardous and toxic materials during store and transportation. |
|||
Uses: | food additive or pharmaceutical intermediates | ||
Synonyms: | Ferrous Fumarate;Ironfumarate;iron(2+) (2E)-but-2-enedioate;1,3-dioxa-2$l2-ferracyclohept-5-ene-4,7-dione; | ||
Molecular Structure: |