111Category: |
Organic chemicals and Derivatives/Aliphatic compounds |
|
CAS NO: |
818-61-1 |
EC NO: |
212-454-9 |
Molecular Formula: |
C5H8O3 |
Molecular Weight: |
116.1152 |
Specification: |
|
InChI: |
InChI=1/C5H8O3/c1-3-5(7)8-4(2)6/h3-4,6H,1H2,2H3 |
Product description:
classification | Chemical Auxiliary Agent | CAS No. | 818-61-1 | Other Names | HEA | MF | C5H8O3 | Place of Origin Packing | Shanghai, China (Mainland) 200Kg/Plastic Drum | Grade Standard | Industrial Grade | Assay | 97% MIN (not include Di-Easter) | Appearance | Colorless Transparent liquid | Application | Emulsion coating agent | Brand Name | Yaxing, | Model Number | Industrial grade | colour | transparent |
|
Synonyms: |
Hydroxyethyl acrylate;2-(Acryloyloxy)ethanol;2-Hydroxyethylester kyseliny akrylove;2-hydroxyethylesterkyselinyakrylove;2-Propenoicacid,2-hydroxyethylester;beta-Hydroxyethyl acrylate;beta-hydroxyethylacrylate;Bisomer 2HEA;bisomer2hea;2-hydroxyethyl prop-2-enoate;1-hydroxyethyl prop-2-enoate; |
Molecular Structure: |
|