Details for Beta Naphthol
![](/images/home/newal1.gif)
Beta Naphthol
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
135-19-3 |
EC NO: |
205-182-7 |
Molecular Formula: |
C10H8O |
Molecular Weight: |
144.1699 |
Specification: |
|
InChI: |
InChI=1/C10H8O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7,11H |
Synonyms: |
C.I. 37500;C.I. Azoic coupling component 1;C.I. Developer 5;betanaphthol;2-naftol;2-naftolo;2-naphtol;antioxygene bn;azogen developer a;azogendevelopera;azoiccouplingcomponent1;beta-monoxynaphthalene;2-hydroxynaphthalene;beta naphthol;beta-naphthol;b-naphtol;naphthalen-2-ol; |
Molecular Structure: |
![Beta Naphthol 135-19-3](https://images-a.chemnet.com/suppliers/chembase/877/103877_1.jpg) |
if you are sourcing Beta Naphthol from Japan ,just feel free to inquire