Details for 2-Methyl Benzyl Chloride
![](/images/home/newal1.gif)
2-Methyl Benzyl Chloride
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
552-45-4 |
EC NO: |
209-013-8 |
Molecular Formula: |
C8H9Cl |
Molecular Weight: |
140.61 |
Specification: |
|
InChI: |
InChI=1/C8H9Cl/c1-7-4-2-3-5-8(7)6-9/h2-5H,6H2,1H3 |
Synonyms: |
1-(Chloromethyl)-2-methylbenzene;o-Xylyl chloride;alpha-Chloro-o-xylene;o-methylbenzyl chloride;2-Methylbenzyl chloride;ortho methylbenzyl chloride;¦Á-Chloro-o-xylene; |
Molecular Structure: |
![2-Methyl Benzyl Chloride 552-45-4](https://images-a.chemnet.com/suppliers/chembase/820/820.gif) |
if you are sourcing 2-Methyl Benzyl Chloride from India ,just feel free to inquire