Details for 4-Methoxy Benzyl Cyanide
![](/images/home/newal1.gif)
4-Methoxy Benzyl Cyanide
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
104-47-2 |
EC NO: |
203-206-0 |
Molecular Formula: |
C9H9NO |
Molecular Weight: |
147.1739 |
Specification: |
|
InChI: |
InChI=1/C9H9NO/c1-11-9-4-2-8(3-5-9)6-7-10/h2-5H,6H2,1H3 |
Synonyms: |
p-Anisyl cyanide;p-Methoxybenzyl cyanide;Benzeneacetonitrile, 4-methoxy-;4-Methoxyphenylacetonitrile;4-Methoxybenzyl cyanide;(4-Methoxyphenyl)acetonitrile;Para Methoxy Phenyl Acetonitrile;PMPAcn;4-MPAN; |
Molecular Structure: |
![4-Methoxy Benzyl Cyanide 104-47-2](https://images-a.chemnet.com/suppliers/chembase/506/5062.gif) |
if you are sourcing 4-Methoxy Benzyl Cyanide from India ,just feel free to inquire