Details for Methyl 2,5-dibromovalerate
![](/images/home/newal1.gif)
Methyl 2,5-dibromovalerate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
50995-48-7 |
EC NO: |
|
Molecular Formula: |
C6H10Br2O2 |
Molecular Weight: |
273.9504 |
Specification: |
|
InChI: |
InChI=1/C6H10Br2O2/c1-10-6(9)5(8)3-2-4-7/h5H,2-4H2,1H3 |
Synonyms: |
Methyl 2,5-dibromopentanoate;2,5-Dibromopentanoic acid methyl ester;2,5-Dibromovaleric acid methyl ester;2,5-Dibromo Ethyl valerate; |
Molecular Structure: |
![Methyl 2,5-dibromovalerate 50995-48-7](https://images-a.chemnet.com/suppliers/chembase/cas/cas50995-48-7.gif) |
if you are sourcing Methyl 2,5-dibromovalerate from Israel ,just feel free to inquire