Details for Methyl 5-bromopentanoate
![](/images/home/newal1.gif)
Methyl 5-bromopentanoate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
5454-83-1 |
EC NO: |
226-709-7 |
Molecular Formula: |
C6H11BrO2 |
Molecular Weight: |
195.0543 |
Specification: |
|
InChI: |
InChI=1/C6H11BrO2/c1-9-6(8)4-2-3-5-7/h2-5H2,1H3 |
Synonyms: |
Methyl 5-bromovalerate, (5-Bromovaleric acid methyl ester);5-Bromovaleric acid methyl ester;methyl 5-bromopentanoate; |
Molecular Structure: |
![Methyl 5-bromopentanoate 5454-83-1](https://images-a.chemnet.com/suppliers/chembase/207/2070.gif) |
if you are sourcing Methyl 5-bromopentanoate from Israel ,just feel free to inquire