Details for 2-Diethylamino Ethyl Chloride Hydrochloride
![](/images/home/newal1.gif)
2-Diethylamino Ethyl Chloride Hydrochloride
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
869-24-9 |
EC NO: |
212-786-4 |
Molecular Formula: |
C6H14ClN¡¤HCl |
Molecular Weight: |
172.09 |
Specification: |
|
InChI: |
InChI=1/C6H14ClN/c1-3-8(4-2)6-5-7/h3-6H2,1-2H3/p+1 |
Synonyms: |
2-(Diethylamino)ethyl chloride hydrochloride;2-Chlorotriethylamine hydrochloride; |
Molecular Structure: |
![2-Diethylamino Ethyl Chloride Hydrochloride 869-24-9](https://images-a.chemnet.com/suppliers/chembase/130/101130_1.gif) |
if you are sourcing 2-Diethylamino Ethyl Chloride Hydrochloride from India ,just feel free to inquire