Details for Methyl Tri Phenyl Phosphonium Iodide
Methyl Tri Phenyl Phosphonium Iodide
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
2065-66-9 |
EC NO: |
218-178-5 |
Molecular Formula: |
C19H19IP |
Molecular Weight: |
405.2318 |
Specification: |
|
InChI: |
InChI=1/C18H15P.CH3I/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2/h1-15H;1H3/p+1 |
Synonyms: |
Methyl Triphenylphosphonium Iodide;methyl triphenyl phosphonium iodide;iodomethane,triphenylphosphonium; |
Molecular Structure: |
|
if you are sourcing Methyl Tri Phenyl Phosphonium Iodide from India ,just feel free to inquire