Details for methyl isobutyl carbinol

methyl isobutyl carbinol
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
108-11-2 |
| EC NO: |
203-551-7 |
| Molecular Formula: |
C6H14O |
| Molecular Weight: |
102.1748 |
| Specification: |
|
| InChI: |
InChI=1/C6H14O/c1-5(2)4-6(3)7/h5-7H,4H2,1-3H3/t6-/m1/s1 |
| Synonyms: |
Isobutyl methyl carbinol;Methyl isobutyl carbinol;methylamyl alcohol;1,3-Dimethyl-1-butanol;1-Methyl-indozole-3-carboxylicacid;2-Methanol-4-pentanol;2-methyl-4-pentano;2-Pentanol,4-methyl-;3-MIC;4-methyl-2-pentano;4-Methyl-2-pentyl alcohol;MIBC;4-methylpentan-2-ol;(2S)-4-methylpentan-2-ol;(2R)-4-methylpentan-2-ol;Methyl amyl alcohol; |
| Molecular Structure: |
 |
if you are sourcing methyl isobutyl carbinol from Japan ,just feel free to inquire