Details for Levulinic acid
Levulinic acid
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
123-76-2 |
EC NO: |
204-649-2 |
Molecular Formula: |
C5H7O3 |
Molecular Weight: |
115.1078 |
Specification: |
|
InChI: |
InChI=1/C5H8O3/c1-4(6)2-3-5(7)8/h2-3H2,1H3,(H,7,8)/p-1 |
Synonyms: |
4-Oxopentanoic acid;Levulinic acid,(4-Ketopentanoic acid;4-Oxopentanoic acid);4-oxovaleric acid;laevulic acid;Levulic Acid;4-Ketopentanoic acid;calcium bis(4-oxopentanoate);2-methyl-3-oxobutanoic acid;sodium 4-oxopentanoate;4-oxopentanoate; |
Molecular Structure: |
|
if you are sourcing Levulinic acid from United-States ,just feel free to inquire