Details for Sodium thioglycolate

Sodium thioglycolate
111Category: |
Organic chemicals and Derivatives/Basic organic raw materials |
|
CAS NO: |
367-51-1 |
EC NO: |
206-696-4 |
Molecular Formula: |
C2H3NaO2S |
Molecular Weight: |
114.0988 |
Specification: |
|
InChI: |
InChI=1/C2H4O2S.Na/c3-2(4)1-5;/h5H,1H2,(H,3,4);/q;+1/p-1 |
Synonyms: |
Thioglycolic acid, sodium salt;Mercaptoacetic acid sodium salt;Sodium mercaptoacetate;Thioglycolic acid sodium salt;sodium sulfanylacetate; |
Molecular Structure: |
 |
if you are sourcing Sodium thioglycolate from United-Kingdom ,just feel free to inquire