Details for 2'-Acetonaphthone

2'-Acetonaphthone
111Category: |
Fragrances and Aroma chemicals |
|
CAS NO: |
93-08-3 |
EC NO: |
202-216-2 |
Molecular Formula: |
C12H10O |
Molecular Weight: |
170.21 |
Specification: |
GC≥99.5% |
InChI: |
InChI=1/C12H10O/c1-9(13)11-7-6-10-4-2-3-5-12(10)8-11/h2-8H,1H3 |
Packing: |
20kg /drum or on request |
Product description:
Chemical Name: 2'-Acetonaphthone
CAS No. 93-08-3
Content: GC≥99.5%
Appearance: white crystal
Packing: 20kg /drum or on request;
Productivity: 5 Tons/M
|
Uses: |
essence and Aroma chemicals |
Synonyms: |
Methyl 2-naphthyl ketone;2-Acetonaphthone;2-Acetylnaphthalene;Acetylnaphtalene;1-(2-Naphthyl)ethan-1-one;Methyl 2-naphth ketone;2-Acetonaphthanone; |
Molecular Structure: |
 |
if you are sourcing 2'-Acetonaphthone from China ,just feel free to inquire