111Category: | Inorganic chemicals |
|
||||||||||||||||||||
CAS NO: | 1633-05-2 | |||||||||||||||||||||
EC NO: | 216-643-7 | |||||||||||||||||||||
Molecular Formula: | SrCO3 | |||||||||||||||||||||
Molecular Weight: | 147.6289 | |||||||||||||||||||||
Specification: | ||||||||||||||||||||||
InChI: | InChI=1/CH2O3.Sr/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 | |||||||||||||||||||||
Packing: | 25kg/bag; 1000kg/bag | |||||||||||||||||||||
Product description: Strontium Carbonate CAS No. : 1633-05-2 Molecular Formula: SrCO3, Molecular Weight: 147.63 Property: White powder, insoluble in water, soluble in water and ammonium containing carbon solution. Heated to 900 degree decomposed into oxidation strontium and carbon dioxide, soluble in rare hydrochloric acid and dilute nitric acid and releasing carbon dioxide. Melting point degree 1497. Usage: Mainly used in magnetic material, cathode ray tube (CRT), nonferrous metal, fireworks, fluorescent glass, flame making and fluorescent material industry, making other strontium salts etc. High purity used in PTC resistors, varistors, MLCC, optical glass, phosphor powder. THIS INSPECTION IS BASED ON HG/T2969-1999
|
||||||||||||||||||||||
Uses: | Mainly used in magnetic material, cathode ray tube (CRT), nonferrous metal, fireworks, fluorescent glass, flame making and fluorescent material industry, making other strontium salts etc. | |||||||||||||||||||||
Synonyms: | C.I. 77837;Strontium carbonate;Strontium carbonate,high purity;Strontium carbonate,electronic grade;Strontiumcarbonate | |||||||||||||||||||||
Molecular Structure: |
![]() |