Details for 2,3-Dichlorotoluene

2,3-Dichlorotoluene
111Category: |
Agrochemicals |
|
CAS NO: |
32768-54-0 |
EC NO: |
251-203-8 |
Molecular Formula: |
C7H6Cl2 |
Molecular Weight: |
161.03 |
Specification: |
|
InChI: |
InChI=1/C7H6Cl2/c1-5-3-2-4-6(8)7(5)9/h2-4H,1H3 |
Packing: |
250KG/drum |
Product description:
Synonyms:2,3-di chloro toluene; 2,3-Dichloro Toluene
Molecular Formula:C7H6Cl2 |
Uses: |
It can be applied in making of pharmacy and pesticide etc |
Synonyms: |
2,3-di chloro toluene;2,3-Dichloro Toluene; |
Molecular Structure: |
 |
if you are sourcing 2,3-Dichlorotoluene from China ,just feel free to inquire