Details for Pigment Orange 5

Pigment Orange 5
111Category: |
Dyestuffs and Pigments |
|
CAS NO: |
3468-63-1 |
EC NO: |
222-429-4 |
Molecular Formula: |
C16H10N4O5 |
Molecular Weight: |
338.2744 |
Specification: |
|
InChI: |
InChI=1/C16H10N4O5/c21-15-8-5-10-3-1-2-4-12(10)16(15)18-17-13-7-6-11(19(22)23)9-14(13)20(24)25/h1-9,17H |
Synonyms: |
C.I. 12075;C.I. Pigment Orange 5;Pigment orange 5;Pigment Orange 5 (C.I.);1-(2,4-dinitrophenylazo)-2-naphthol;Permanent orange;Pigment Orange 5;1-[(2,4-dinitrophenyl)hydrazono]naphthalen-2(1H)-one; |
Molecular Structure: |
 |
if you are sourcing Pigment Orange 5 from China ,just feel free to inquire